C11H16O — CID 146246430
3,4a-dimethyl-2,3,4,8a-tetrahydrochromene (PubChem CID 146246430) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is 3,4a-dimethyl-2,3,4,8a-tetrahydrochromene.
| Compound Name | 3,4a-dimethyl-2,3,4,8a-tetrahydrochromene |
|---|---|
| PubChem CID | 146246430 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 3,4a-dimethyl-2,3,4,8a-tetrahydrochromene |
| SMILES | CC1COC2C=CC=CC2(C)C1 |
| InChI | InChI=1S/C11H16O/c1-9-7-11(2)6-4-3-5-10(11)12-8-9/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | WBVGPZAWSJCBGF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |