C8H16O3 — CID 134289608
(2R,5R)-2-(hydroxymethyl)-3,5-dimethyloxan-3-ol (PubChem CID 134289608) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R,5R)-2-(hydroxymethyl)-3,5-dimethyloxan-3-ol.
| Compound Name | (2R,5R)-2-(hydroxymethyl)-3,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 134289608 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R,5R)-2-(hydroxymethyl)-3,5-dimethyloxan-3-ol |
| SMILES | C[C@H]1CO[C@H](CO)C(C)(O)C1 |
| InChI | InChI=1S/C8H16O3/c1-6-3-8(2,10)7(4-9)11-5-6/h6-7,9-10H,3-5H2,1-2H3/t6-,7-,8?/m1/s1 |
| InChIKey | YLELMJRFLBFIKR-GCJDJSOWSA-N |
| XLogP | 0.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |