C9H18O5 — CID 23530499
2-(hydroxymethyl)-3,4,5-trimethyloxane-3,4,5-triol (PubChem CID 23530499) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,4,5-trimethyloxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-3,4,5-trimethyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 23530499 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(hydroxymethyl)-3,4,5-trimethyloxane-3,4,5-triol |
| SMILES | CC1(O)COC(CO)C(C)(O)C1(C)O |
| InChI | InChI=1S/C9H18O5/c1-7(11)5-14-6(4-10)8(2,12)9(7,3)13/h6,10-13H,4-5H2,1-3H3 |
| InChIKey | XHTALGGYZBLWAB-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |