C10H12Br2 — CID 175543019
5-bromo-6-(bromomethyl)-5-prop-2-enylcyclohexa-1,3-diene (PubChem CID 175543019) has the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. Its IUPAC name is 5-bromo-6-(bromomethyl)-5-prop-2-enylcyclohexa-1,3-diene.
| Compound Name | 5-bromo-6-(bromomethyl)-5-prop-2-enylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175543019 |
| Molecular Formula | C10H12Br2 |
| Molecular Weight | 292.01 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 5-bromo-6-(bromomethyl)-5-prop-2-enylcyclohexa-1,3-diene |
| SMILES | C=CCC1(Br)C=CC=CC1CBr |
| InChI | InChI=1S/C10H12Br2/c1-2-6-10(12)7-4-3-5-9(10)8-11/h2-5,7,9H,1,6,8H2 |
| InChIKey | KYHJCSFJDGSCGP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.01 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|