C10H13Br3 — CID 174704958
5-(2-bromoethyl)-5,6-bis(bromomethyl)cyclohexa-1,3-diene (PubChem CID 174704958) has the molecular formula C10H13Br3 and a molecular weight of 372.93 g/mol. Its IUPAC name is 5-(2-bromoethyl)-5,6-bis(bromomethyl)cyclohexa-1,3-diene.
| Compound Name | 5-(2-bromoethyl)-5,6-bis(bromomethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 174704958 |
| Molecular Formula | C10H13Br3 |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 369.86 |
| IUPAC Name | 5-(2-bromoethyl)-5,6-bis(bromomethyl)cyclohexa-1,3-diene |
| SMILES | BrCCC1(CBr)C=CC=CC1CBr |
| InChI | InChI=1S/C10H13Br3/c11-6-5-10(8-13)4-2-1-3-9(10)7-12/h1-4,9H,5-8H2 |
| InChIKey | LNYXENHRNLAEOC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|