C34H32Br8 — CID 87907670
1,3,5,7-tetrakis(1,6-dibromocyclohexa-2,4-dien-1-yl)adamantane (PubChem CID 87907670) has the molecular formula C34H32Br8 and a molecular weight of 1079.86 g/mol. Its IUPAC name is 1,3,5,7-tetrakis(1,6-dibromocyclohexa-2,4-dien-1-yl)adamantane.
| Compound Name | 1,3,5,7-tetrakis(1,6-dibromocyclohexa-2,4-dien-1-yl)adamantane |
|---|---|
| PubChem CID | 87907670 |
| Molecular Formula | C34H32Br8 |
| Molecular Weight | 1079.86 g/mol |
| Exact Mass | 1071.60 |
| IUPAC Name | 1,3,5,7-tetrakis(1,6-dibromocyclohexa-2,4-dien-1-yl)adamantane |
| SMILES | BrC1C=CC=CC1(Br)C12CC3(C4(Br)C=CC=CC4Br)CC(C4(Br)C=CC=CC4Br)(C1)CC(C1(Br)C=CC=CC1Br)(C2)C3 |
| InChI | InChI=1S/C34H32Br8/c35-23-9-1-5-13-31(23,39)27-17-28(32(40)14-6-2-10-24(32)36)20-29(18-27,33(41)15-7-3-11-25(33)37)22-30(19-27,21-28)34(42)16-8-4-12-26(34)38/h1-16,23-26H,17-22H2 |
| InChIKey | VUPDTIHSHIIONT-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.86 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|