C8H5BrN2 — CID 155672936
1-bromocyclohexa-3,5-diene-1,2-dicarbonitrile (PubChem CID 155672936) has the molecular formula C8H5BrN2 and a molecular weight of 209.05 g/mol. Its IUPAC name is 1-bromocyclohexa-3,5-diene-1,2-dicarbonitrile.
| Compound Name | 1-bromocyclohexa-3,5-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 155672936 |
| Molecular Formula | C8H5BrN2 |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | 1-bromocyclohexa-3,5-diene-1,2-dicarbonitrile |
| SMILES | N#CC1C=CC=CC1(Br)C#N |
| InChI | InChI=1S/C8H5BrN2/c9-8(6-11)4-2-1-3-7(8)5-10/h1-4,7H |
| InChIKey | PVQZIQPFKHBKGU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|