C9H9BrN2 — CID 174419119
(6-bromo-1-ethenylcyclohexa-2,4-dien-1-yl)cyanamide (PubChem CID 174419119) has the molecular formula C9H9BrN2 and a molecular weight of 225.09 g/mol. Its IUPAC name is (6-bromo-1-ethenylcyclohexa-2,4-dien-1-yl)cyanamide.
| Compound Name | (6-bromo-1-ethenylcyclohexa-2,4-dien-1-yl)cyanamide |
|---|---|
| PubChem CID | 174419119 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | (6-bromo-1-ethenylcyclohexa-2,4-dien-1-yl)cyanamide |
| SMILES | C=CC1(NC#N)C=CC=CC1Br |
| InChI | InChI=1S/C9H9BrN2/c1-2-9(12-7-11)6-4-3-5-8(9)10/h2-6,8,12H,1H2 |
| InChIKey | VAHNUCGYSNPPEI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|