C11H15N — CID 142922310
6-[(1E)-buta-1,3-dienyl]-6-methylcyclohexa-2,4-dien-1-amine (PubChem CID 142922310) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 6-[(1E)-buta-1,3-dienyl]-6-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 6-[(1E)-buta-1,3-dienyl]-6-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142922310 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 6-[(1E)-buta-1,3-dienyl]-6-methylcyclohexa-2,4-dien-1-amine |
| SMILES | C=C/C=C/C1(C)C=CC=CC1N |
| InChI | InChI=1S/C11H15N/c1-3-4-8-11(2)9-6-5-7-10(11)12/h3-10H,1,12H2,2H3/b8-4+ |
| InChIKey | RESBWRAJRBOOMB-XBXARRHUSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|