C12H14N2 — CID 142296123
3-[(1Z)-buta-1,3-dienyl]-1-azaspiro[3.5]nona-2,5,7-trien-1-amine (PubChem CID 142296123) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-1-azaspiro[3.5]nona-2,5,7-trien-1-amine.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-1-azaspiro[3.5]nona-2,5,7-trien-1-amine |
|---|---|
| PubChem CID | 142296123 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-1-azaspiro[3.5]nona-2,5,7-trien-1-amine |
| SMILES | C=C/C=C\C1=CN(N)C12C=CC=CC2 |
| InChI | InChI=1S/C12H14N2/c1-2-3-7-11-10-14(13)12(11)8-5-4-6-9-12/h2-8,10H,1,9,13H2/b7-3- |
| InChIKey | PRKTXLGZCDOTSD-CLTKARDFSA-N |
| XLogP | 2.06 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|