C14H20O — CID 141008541
(E)-3-(6-tert-butyl-1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal (PubChem CID 141008541) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (E)-3-(6-tert-butyl-1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal.
| Compound Name | (E)-3-(6-tert-butyl-1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal |
|---|---|
| PubChem CID | 141008541 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (E)-3-(6-tert-butyl-1-methylcyclohexa-2,4-dien-1-yl)prop-2-enal |
| SMILES | CC(C)(C)C1C=CC=CC1(C)/C=C/C=O |
| InChI | InChI=1S/C14H20O/c1-13(2,3)12-8-5-6-9-14(12,4)10-7-11-15/h5-12H,1-4H3/b10-7+ |
| InChIKey | VKJXUEFPWSACQN-JXMROGBWSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|