C7H8BrIO — CID 169228146
6-bromo-5-iodo-5-methoxycyclohexa-1,3-diene (PubChem CID 169228146) has the molecular formula C7H8BrIO and a molecular weight of 314.95 g/mol. Its IUPAC name is 6-bromo-5-iodo-5-methoxycyclohexa-1,3-diene.
| Compound Name | 6-bromo-5-iodo-5-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 169228146 |
| Molecular Formula | C7H8BrIO |
| Molecular Weight | 314.95 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | 6-bromo-5-iodo-5-methoxycyclohexa-1,3-diene |
| SMILES | COC1(I)C=CC=CC1Br |
| InChI | InChI=1S/C7H8BrIO/c1-10-7(9)5-3-2-4-6(7)8/h2-6H,1H3 |
| InChIKey | APYGPIGFCZBGBW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.95 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|