C20H24S — CID 141423884
6-cyclohexyl-5-ethenyl-5-phenylsulfanylcyclohexa-1,3-diene (PubChem CID 141423884) has the molecular formula C20H24S and a molecular weight of 296.48 g/mol. Its IUPAC name is 6-cyclohexyl-5-ethenyl-5-phenylsulfanylcyclohexa-1,3-diene.
| Compound Name | 6-cyclohexyl-5-ethenyl-5-phenylsulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141423884 |
| Molecular Formula | C20H24S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 6-cyclohexyl-5-ethenyl-5-phenylsulfanylcyclohexa-1,3-diene |
| SMILES | C=CC1(Sc2ccccc2)C=CC=CC1C1CCCCC1 |
| InChI | InChI=1S/C20H24S/c1-2-20(21-18-13-7-4-8-14-18)16-10-9-15-19(20)17-11-5-3-6-12-17/h2,4,7-10,13-17,19H,1,3,5-6,11-12H2 |
| InChIKey | NIFMQPVDOBHMLH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|