C13H18O2 — CID 155797646
6-cyclohexyl-1-hydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 155797646) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is 6-cyclohexyl-1-hydroxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 6-cyclohexyl-1-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 155797646 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 6-cyclohexyl-1-hydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(O)C=CC=CC1C1CCCCC1 |
| InChI | InChI=1S/C13H18O2/c14-10-13(15)9-5-4-8-12(13)11-6-2-1-3-7-11/h4-5,8-12,15H,1-3,6-7H2 |
| InChIKey | YOQBHLFFQWINQY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|