C15H24O — CID 174431333
6-cyclohexyl-4,4-dimethylcyclohex-2-ene-1-carbaldehyde (PubChem CID 174431333) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 6-cyclohexyl-4,4-dimethylcyclohex-2-ene-1-carbaldehyde.
| Compound Name | 6-cyclohexyl-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 174431333 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 6-cyclohexyl-4,4-dimethylcyclohex-2-ene-1-carbaldehyde |
| SMILES | CC1(C)C=CC(C=O)C(C2CCCCC2)C1 |
| InChI | InChI=1S/C15H24O/c1-15(2)9-8-13(11-16)14(10-15)12-6-4-3-5-7-12/h8-9,11-14H,3-7,10H2,1-2H3 |
| InChIKey | IYRBAKRQHOFUDY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|