C12H20 — CID 10374770
(3S,3aR,7aR)-3,5,5-trimethyl-1,2,3,3a,4,7a-hexahydroindene (PubChem CID 10374770) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (3S,3aR,7aR)-3,5,5-trimethyl-1,2,3,3a,4,7a-hexahydroindene.
| Compound Name | (3S,3aR,7aR)-3,5,5-trimethyl-1,2,3,3a,4,7a-hexahydroindene |
|---|---|
| PubChem CID | 10374770 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (3S,3aR,7aR)-3,5,5-trimethyl-1,2,3,3a,4,7a-hexahydroindene |
| SMILES | C[C@H]1CC[C@@H]2C=CC(C)(C)C[C@H]12 |
| InChI | InChI=1S/C12H20/c1-9-4-5-10-6-7-12(2,3)8-11(9)10/h6-7,9-11H,4-5,8H2,1-3H3/t9-,10+,11+/m0/s1 |
| InChIKey | QSGALVUXZUTYDM-HBNTYKKESA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|