C25H32Br2O — CID 151917256
bis(1-bromo-6-cyclohexylcyclohexa-2,4-dien-1-yl)methanone (PubChem CID 151917256) has the molecular formula C25H32Br2O and a molecular weight of 508.34 g/mol. Its IUPAC name is bis(1-bromo-6-cyclohexylcyclohexa-2,4-dien-1-yl)methanone.
| Compound Name | bis(1-bromo-6-cyclohexylcyclohexa-2,4-dien-1-yl)methanone |
|---|---|
| PubChem CID | 151917256 |
| Molecular Formula | C25H32Br2O |
| Molecular Weight | 508.34 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | bis(1-bromo-6-cyclohexylcyclohexa-2,4-dien-1-yl)methanone |
| SMILES | O=C(C1(Br)C=CC=CC1C1CCCCC1)C1(Br)C=CC=CC1C1CCCCC1 |
| InChI | InChI=1S/C25H32Br2O/c26-24(17-9-7-15-21(24)19-11-3-1-4-12-19)23(28)25(27)18-10-8-16-22(25)20-13-5-2-6-14-20/h7-10,15-22H,1-6,11-14H2 |
| InChIKey | SWACHPXTFLZERQ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.34 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|