C18H27NO — CID 101089270
N,N-dicyclohexylcyclopenta-2,4-diene-1-carboxamide (PubChem CID 101089270) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is N,N-dicyclohexylcyclopenta-2,4-diene-1-carboxamide.
| Compound Name | N,N-dicyclohexylcyclopenta-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 101089270 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N,N-dicyclohexylcyclopenta-2,4-diene-1-carboxamide |
| SMILES | O=C(C1C=CC=C1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C18H27NO/c20-18(15-9-7-8-10-15)19(16-11-3-1-4-12-16)17-13-5-2-6-14-17/h7-10,15-17H,1-6,11-14H2 |
| InChIKey | ILCQBLGFKPCVMD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |