C25H44N2Se — CID 134917279
1,1,3,3-tetracyclohexylselenourea (PubChem CID 134917279) has the molecular formula C25H44N2Se and a molecular weight of 451.60 g/mol. Its IUPAC name is 1,1,3,3-tetracyclohexylselenourea.
| Compound Name | 1,1,3,3-tetracyclohexylselenourea |
|---|---|
| PubChem CID | 134917279 |
| Molecular Formula | C25H44N2Se |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 1,1,3,3-tetracyclohexylselenourea |
| SMILES | [Se]=C(N(C1CCCCC1)C1CCCCC1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C25H44N2Se/c28-25(26(21-13-5-1-6-14-21)22-15-7-2-8-16-22)27(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h21-24H,1-20H2 |
| InChIKey | RUWXKGKTZHGSFX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|