C21H37N3 — CID 68836452
1,1,3,3-tetracyclopentylguanidine (PubChem CID 68836452) has the molecular formula C21H37N3 and a molecular weight of 331.55 g/mol. Its IUPAC name is 1,1,3,3-tetracyclopentylguanidine.
| Compound Name | 1,1,3,3-tetracyclopentylguanidine |
|---|---|
| PubChem CID | 68836452 |
| Molecular Formula | C21H37N3 |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 1,1,3,3-tetracyclopentylguanidine |
| SMILES | [H]N=C(N(C1CCCC1)C1CCCC1)N(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C21H37N3/c22-21(23(17-9-1-2-10-17)18-11-3-4-12-18)24(19-13-5-6-14-19)20-15-7-8-16-20/h17-20,22H,1-16H2 |
| InChIKey | SUWODBABOBOTDL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|