C14H24INO — CID 71405486
N,N-dicyclohexyl-2-iodoacetamide (PubChem CID 71405486) has the molecular formula C14H24INO and a molecular weight of 349.26 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-iodoacetamide.
| Compound Name | N,N-dicyclohexyl-2-iodoacetamide |
|---|---|
| PubChem CID | 71405486 |
| Molecular Formula | C14H24INO |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N,N-dicyclohexyl-2-iodoacetamide |
| SMILES | O=C(CI)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H24INO/c15-11-14(17)16(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h12-13H,1-11H2 |
| InChIKey | IIGVVHGTRHCDMG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|