C48H81N3O6 — CID 86183778
2-[3,5-bis[2-(dicyclohexylamino)-2-oxoethoxy]cyclohexyl]oxy-N,N-dicyclohexylacetamide (PubChem CID 86183778) has the molecular formula C48H81N3O6 and a molecular weight of 796.19 g/mol. Its IUPAC name is 2-[3,5-bis[2-(dicyclohexylamino)-2-oxoethoxy]cyclohexyl]oxy-N,N-dicyclohexylacetamide.
| Compound Name | 2-[3,5-bis[2-(dicyclohexylamino)-2-oxoethoxy]cyclohexyl]oxy-N,N-dicyclohexylacetamide |
|---|---|
| PubChem CID | 86183778 |
| Molecular Formula | C48H81N3O6 |
| Molecular Weight | 796.19 g/mol |
| Exact Mass | 795.61 |
| IUPAC Name | 2-[3,5-bis[2-(dicyclohexylamino)-2-oxoethoxy]cyclohexyl]oxy-N,N-dicyclohexylacetamide |
| SMILES | O=C(COC1CC(OCC(=O)N(C2CCCCC2)C2CCCCC2)CC(OCC(=O)N(C2CCCCC2)C2CCCCC2)C1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C48H81N3O6/c52-46(49(37-19-7-1-8-20-37)38-21-9-2-10-22-38)34-55-43-31-44(56-35-47(53)50(39-23-11-3-12-24-39)40-25-13-4-14-26-40)33-45(32-43)57-36-48(54)51(41-27-15-5-16-28-41)42-29-17-6-18-30-42/h37-45H,1-36H2 |
| InChIKey | FRAGDACYLFLGQR-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.19 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |