C15H26N2O3 — CID 3049615
N',N'-dicyclohexyl-N-hydroxypropanediamide (PubChem CID 3049615) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is N',N'-dicyclohexyl-N-hydroxypropanediamide.
| Compound Name | N',N'-dicyclohexyl-N-hydroxypropanediamide |
|---|---|
| PubChem CID | 3049615 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N',N'-dicyclohexyl-N-hydroxypropanediamide |
| SMILES | O=C(CC(=O)N(C1CCCCC1)C1CCCCC1)NO |
| InChI | InChI=1S/C15H26N2O3/c18-14(16-20)11-15(19)17(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h12-13,20H,1-11H2,(H,16,18) |
| InChIKey | FPBUXJKFUIXOQN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|