C21H39N3O — CID 67746921
N,N-dicyclohexyl-2-(2-piperidin-1-ylethylamino)acetamide (PubChem CID 67746921) has the molecular formula C21H39N3O and a molecular weight of 349.56 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(2-piperidin-1-ylethylamino)acetamide.
| Compound Name | N,N-dicyclohexyl-2-(2-piperidin-1-ylethylamino)acetamide |
|---|---|
| PubChem CID | 67746921 |
| Molecular Formula | C21H39N3O |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | N,N-dicyclohexyl-2-(2-piperidin-1-ylethylamino)acetamide |
| SMILES | O=C(CNCCN1CCCCC1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H39N3O/c25-21(18-22-14-17-23-15-8-3-9-16-23)24(19-10-4-1-5-11-19)20-12-6-2-7-13-20/h19-20,22H,1-18H2 |
| InChIKey | FPKHXLVSPCJOTI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|