C21H38N2O2 — CID 67746963
N,N-dicyclohexyl-5-morpholin-4-ylpentanamide (PubChem CID 67746963) has the molecular formula C21H38N2O2 and a molecular weight of 350.55 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-morpholin-4-ylpentanamide.
| Compound Name | N,N-dicyclohexyl-5-morpholin-4-ylpentanamide |
|---|---|
| PubChem CID | 67746963 |
| Molecular Formula | C21H38N2O2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | N,N-dicyclohexyl-5-morpholin-4-ylpentanamide |
| SMILES | O=C(CCCCN1CCOCC1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H38N2O2/c24-21(13-7-8-14-22-15-17-25-18-16-22)23(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h19-20H,1-18H2 |
| InChIKey | WGFLCCCGQXZVFR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|