About N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane
N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane (PubChem CID 158754691) has the molecular formula C21H42N2O3
and a molecular weight of 370.58 g/mol. Its IUPAC name is N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane.
Molecular Properties
| Compound Name | N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane |
| PubChem CID | 158754691 |
| Molecular Formula | C21H42N2O3 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane |
| SMILES | C.CCCCCCCC(=O)N(OCCN1CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H38N2O3.CH4/c1-2-3-4-5-9-12-20(23)22(19-10-7-6-8-11-19)25-18-15-21-13-16-24-17-14-21;/h19H,2-18H2,1H3;1H4 |
| InChIKey | INXMQGVCWCYQAU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane?
The IUPAC name of N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane (CID 158754691) is N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane.
What is the SMILES notation for N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane?
The canonical SMILES for N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane is C.CCCCCCCC(=O)N(OCCN1CCOCC1)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane?
The InChIKey is INXMQGVCWCYQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38N2O3.CH4/c1-2-3-4-5-9-12-20(23)22(19-10-7-6-8-11-19)25-18-15-21-13-16-24-17-14-21;/h19H,2-18H2,1H3;1H4.
What are the key properties of N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane?
N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane has a molecular weight of 370.58 g/mol, XLogP of 4.41, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N-(2-morpholin-4-ylethoxy)octanamide;methane is sourced from PubChem (CID 158754691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).