C15H26Cl2N2O2Ti — CID 173136057
N',N'-dicyclohexylpropanediamide;titanium(2+);dichloride (PubChem CID 173136057) has the molecular formula C15H26Cl2N2O2Ti and a molecular weight of 385.16 g/mol. Its IUPAC name is N',N'-dicyclohexylpropanediamide;titanium(2+);dichloride.
| Compound Name | N',N'-dicyclohexylpropanediamide;titanium(2+);dichloride |
|---|---|
| PubChem CID | 173136057 |
| Molecular Formula | C15H26Cl2N2O2Ti |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N',N'-dicyclohexylpropanediamide;titanium(2+);dichloride |
| SMILES | NC(=O)CC(=O)N(C1CCCCC1)C1CCCCC1.[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C15H26N2O2.2ClH.Ti/c16-14(18)11-15(19)17(12-7-3-1-4-8-12)13-9-5-2-6-10-13;;;/h12-13H,1-11H2,(H2,16,18);2*1H;/q;;;+2/p-2 |
| InChIKey | CXBWGEPZINPKIQ-UHFFFAOYSA-L |
| XLogP | -3.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|