C48H75N3 — CID 171722657
N-[1-[3,5-bis[1-(dicyclohexylamino)ethenyl]phenyl]ethenyl]-N-cyclohexylcyclohexanamine (PubChem CID 171722657) has the molecular formula C48H75N3 and a molecular weight of 694.15 g/mol. Its IUPAC name is N-[1-[3,5-bis[1-(dicyclohexylamino)ethenyl]phenyl]ethenyl]-N-cyclohexylcyclohexanamine.
| Compound Name | N-[1-[3,5-bis[1-(dicyclohexylamino)ethenyl]phenyl]ethenyl]-N-cyclohexylcyclohexanamine |
|---|---|
| PubChem CID | 171722657 |
| Molecular Formula | C48H75N3 |
| Molecular Weight | 694.15 g/mol |
| Exact Mass | 693.60 |
| IUPAC Name | N-[1-[3,5-bis[1-(dicyclohexylamino)ethenyl]phenyl]ethenyl]-N-cyclohexylcyclohexanamine |
| SMILES | C=C(c1cc(C(=C)N(C2CCCCC2)C2CCCCC2)cc(C(=C)N(C2CCCCC2)C2CCCCC2)c1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C48H75N3/c1-37(49(43-22-10-4-11-23-43)44-24-12-5-13-25-44)40-34-41(38(2)50(45-26-14-6-15-27-45)46-28-16-7-17-29-46)36-42(35-40)39(3)51(47-30-18-8-19-31-47)48-32-20-9-21-33-48/h34-36,43-48H,1-33H2 |
| InChIKey | RPWKZEAYDBODIE-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.15 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |