C46H70N4O4 — CID 19098678
1-N,3-N-dicyclohexyl-1-N,3-N-bis[2,2,6,6-tetramethyl-1-(2-methylprop-2-enoyl)piperidin-4-yl]benzene-1,3-dicarboxamide (PubChem CID 19098678) has the molecular formula C46H70N4O4 and a molecular weight of 743.09 g/mol. Its IUPAC name is 1-N,3-N-dicyclohexyl-1-N,3-N-bis[2,2,6,6-tetramethyl-1-(2-methylprop-2-enoyl)piperidin-4-yl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-dicyclohexyl-1-N,3-N-bis[2,2,6,6-tetramethyl-1-(2-methylprop-2-enoyl)piperidin-4-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19098678 |
| Molecular Formula | C46H70N4O4 |
| Molecular Weight | 743.09 g/mol |
| Exact Mass | 742.54 |
| IUPAC Name | 1-N,3-N-dicyclohexyl-1-N,3-N-bis[2,2,6,6-tetramethyl-1-(2-methylprop-2-enoyl)piperidin-4-yl]benzene-1,3-dicarboxamide |
| SMILES | C=C(C)C(=O)N1C(C)(C)CC(N(C(=O)c2cccc(C(=O)N(C3CCCCC3)C3CC(C)(C)N(C(=O)C(=C)C)C(C)(C)C3)c2)C2CCCCC2)CC1(C)C |
| InChI | InChI=1S/C46H70N4O4/c1-31(2)39(51)49-43(5,6)27-37(28-44(49,7)8)47(35-22-15-13-16-23-35)41(53)33-20-19-21-34(26-33)42(54)48(36-24-17-14-18-25-36)38-29-45(9,10)50(40(52)32(3)4)46(11,12)30-38/h19-21,26,35-38H,1,3,13-18,22-25,27-30H2,2,4-12H3 |
| InChIKey | VEKCPIBPSQEICS-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.09 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|