C19H24N2O3S — CID 47789881
N-cyclohexyl-N-cyclopropyl-3-(prop-2-ynylsulfamoyl)benzamide (PubChem CID 47789881) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-cyclohexyl-N-cyclopropyl-3-(prop-2-ynylsulfamoyl)benzamide.
| Compound Name | N-cyclohexyl-N-cyclopropyl-3-(prop-2-ynylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 47789881 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-cyclohexyl-N-cyclopropyl-3-(prop-2-ynylsulfamoyl)benzamide |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)N(C2CCCCC2)C2CC2)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-2-13-20-25(23,24)18-10-6-7-15(14-18)19(22)21(17-11-12-17)16-8-4-3-5-9-16/h1,6-7,10,14,16-17,20H,3-5,8-9,11-13H2 |
| InChIKey | FZIFJEMVNRICDM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|