C22H25FN2O3S — CID 47074499
N-cyclohexyl-N-cyclopropyl-3-[(2-fluorophenyl)sulfamoyl]benzamide (PubChem CID 47074499) has the molecular formula C22H25FN2O3S and a molecular weight of 416.52 g/mol. Its IUPAC name is N-cyclohexyl-N-cyclopropyl-3-[(2-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-cyclohexyl-N-cyclopropyl-3-[(2-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 47074499 |
| Molecular Formula | C22H25FN2O3S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-cyclohexyl-N-cyclopropyl-3-[(2-fluorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(c1cccc(S(=O)(=O)Nc2ccccc2F)c1)N(C1CCCCC1)C1CC1 |
| InChI | InChI=1S/C22H25FN2O3S/c23-20-11-4-5-12-21(20)24-29(27,28)19-10-6-7-16(15-19)22(26)25(18-13-14-18)17-8-2-1-3-9-17/h4-7,10-12,15,17-18,24H,1-3,8-9,13-14H2 |
| InChIKey | QBTFTPJTVGYFOF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |