C25H26FN3O4S — CID 24516663
3-[(2-fluorophenyl)sulfamoyl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide (PubChem CID 24516663) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)sulfamoyl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide.
| Compound Name | 3-[(2-fluorophenyl)sulfamoyl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 24516663 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[(2-fluorophenyl)sulfamoyl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]benzamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)c1cccc(S(=O)(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C25H26FN3O4S/c1-28(18-19-9-11-21(12-10-19)29-13-15-33-16-14-29)25(30)20-5-4-6-22(17-20)34(31,32)27-24-8-3-2-7-23(24)26/h2-12,17,27H,13-16,18H2,1H3 |
| InChIKey | HGRXBBQRFKMRBL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|