C22H20F2N2O4S — CID 17438125
N-[(3-fluoro-4-methoxyphenyl)methyl]-3-[(2-fluorophenyl)sulfamoyl]-N-methylbenzamide (PubChem CID 17438125) has the molecular formula C22H20F2N2O4S and a molecular weight of 446.48 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-3-[(2-fluorophenyl)sulfamoyl]-N-methylbenzamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-3-[(2-fluorophenyl)sulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 17438125 |
| Molecular Formula | C22H20F2N2O4S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-3-[(2-fluorophenyl)sulfamoyl]-N-methylbenzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2cccc(S(=O)(=O)Nc3ccccc3F)c2)cc1F |
| InChI | InChI=1S/C22H20F2N2O4S/c1-26(14-15-10-11-21(30-2)19(24)12-15)22(27)16-6-5-7-17(13-16)31(28,29)25-20-9-4-3-8-18(20)23/h3-13,25H,14H2,1-2H3 |
| InChIKey | DBNOGLQTPIVAGW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |