C17H24OS — CID 101265602
(1S,2R)-1-cyclohexyl-2-methyl-3-phenylsulfanylbut-3-en-1-ol (PubChem CID 101265602) has the molecular formula C17H24OS and a molecular weight of 276.44 g/mol. Its IUPAC name is (1S,2R)-1-cyclohexyl-2-methyl-3-phenylsulfanylbut-3-en-1-ol.
| Compound Name | (1S,2R)-1-cyclohexyl-2-methyl-3-phenylsulfanylbut-3-en-1-ol |
|---|---|
| PubChem CID | 101265602 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (1S,2R)-1-cyclohexyl-2-methyl-3-phenylsulfanylbut-3-en-1-ol |
| SMILES | C=C(Sc1ccccc1)[C@H](C)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C17H24OS/c1-13(17(18)15-9-5-3-6-10-15)14(2)19-16-11-7-4-8-12-16/h4,7-8,11-13,15,17-18H,2-3,5-6,9-10H2,1H3/t13-,17+/m0/s1 |
| InChIKey | XPGLIEVBWRRJSB-SUMWQHHRSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |