C19H20OS — CID 101265605
(1E,3R,4R)-4-methyl-1-phenyl-5-phenylsulfanylhexa-1,5-dien-3-ol (PubChem CID 101265605) has the molecular formula C19H20OS and a molecular weight of 296.44 g/mol. Its IUPAC name is (1E,3R,4R)-4-methyl-1-phenyl-5-phenylsulfanylhexa-1,5-dien-3-ol.
| Compound Name | (1E,3R,4R)-4-methyl-1-phenyl-5-phenylsulfanylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 101265605 |
| Molecular Formula | C19H20OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1E,3R,4R)-4-methyl-1-phenyl-5-phenylsulfanylhexa-1,5-dien-3-ol |
| SMILES | C=C(Sc1ccccc1)[C@H](C)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H20OS/c1-15(16(2)21-18-11-7-4-8-12-18)19(20)14-13-17-9-5-3-6-10-17/h3-15,19-20H,2H2,1H3/b14-13+/t15-,19+/m0/s1 |
| InChIKey | INFBGCZPOCJBFJ-UHTSDLRISA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |