C24H40O3Si — CID 101204238
(E,2R,5S,6S)-6-hydroxy-5-methyl-8-phenyl-2-tri(propan-2-yl)silyloxyoct-7-en-4-one (PubChem CID 101204238) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is (E,2R,5S,6S)-6-hydroxy-5-methyl-8-phenyl-2-tri(propan-2-yl)silyloxyoct-7-en-4-one.
| Compound Name | (E,2R,5S,6S)-6-hydroxy-5-methyl-8-phenyl-2-tri(propan-2-yl)silyloxyoct-7-en-4-one |
|---|---|
| PubChem CID | 101204238 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (E,2R,5S,6S)-6-hydroxy-5-methyl-8-phenyl-2-tri(propan-2-yl)silyloxyoct-7-en-4-one |
| SMILES | CC(C)[Si](O[C@H](C)CC(=O)[C@@H](C)[C@@H](O)/C=C/c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H40O3Si/c1-17(2)28(18(3)4,19(5)6)27-20(7)16-24(26)21(8)23(25)15-14-22-12-10-9-11-13-22/h9-15,17-21,23,25H,16H2,1-8H3/b15-14+/t20-,21+,23+/m1/s1 |
| InChIKey | MYFMMYLGHVELAL-DVUTXCTHSA-N |
| XLogP | 6.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|