C16H20O2 — CID 134942948
1-cyclohexyl-4-phenylbut-3-yne-1,2-diol (PubChem CID 134942948) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-cyclohexyl-4-phenylbut-3-yne-1,2-diol.
| Compound Name | 1-cyclohexyl-4-phenylbut-3-yne-1,2-diol |
|---|---|
| PubChem CID | 134942948 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 1-cyclohexyl-4-phenylbut-3-yne-1,2-diol |
| SMILES | OC(C#Cc1ccccc1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C16H20O2/c17-15(12-11-13-7-3-1-4-8-13)16(18)14-9-5-2-6-10-14/h1,3-4,7-8,14-18H,2,5-6,9-10H2 |
| InChIKey | BIZFTKMJDJRKFU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|