C18H25N — CID 55069022
1-cyclohexyl-N-(3-phenylprop-2-ynyl)propan-1-amine (PubChem CID 55069022) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is 1-cyclohexyl-N-(3-phenylprop-2-ynyl)propan-1-amine.
| Compound Name | 1-cyclohexyl-N-(3-phenylprop-2-ynyl)propan-1-amine |
|---|---|
| PubChem CID | 55069022 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 1-cyclohexyl-N-(3-phenylprop-2-ynyl)propan-1-amine |
| SMILES | CCC(NCC#Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H25N/c1-2-18(17-13-7-4-8-14-17)19-15-9-12-16-10-5-3-6-11-16/h3,5-6,10-11,17-19H,2,4,7-8,13-15H2,1H3 |
| InChIKey | WIRQOWQPBSYLSK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|