C14H18OS — CID 177445922
(1S)-1-[(1S,2S)-2-ethenyl-1-methyl-2-phenylsulfanylcyclopropyl]ethanol (PubChem CID 177445922) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is (1S)-1-[(1S,2S)-2-ethenyl-1-methyl-2-phenylsulfanylcyclopropyl]ethanol.
| Compound Name | (1S)-1-[(1S,2S)-2-ethenyl-1-methyl-2-phenylsulfanylcyclopropyl]ethanol |
|---|---|
| PubChem CID | 177445922 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (1S)-1-[(1S,2S)-2-ethenyl-1-methyl-2-phenylsulfanylcyclopropyl]ethanol |
| SMILES | C=C[C@@]1(Sc2ccccc2)C[C@@]1(C)[C@H](C)O |
| InChI | InChI=1S/C14H18OS/c1-4-14(10-13(14,3)11(2)15)16-12-8-6-5-7-9-12/h4-9,11,15H,1,10H2,2-3H3/t11-,13-,14+/m0/s1 |
| InChIKey | MEZAHUIZYJOUFG-FPMFFAJLSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|