C5H4Br2 — CID 67503363
5,5-dibromocyclopenta-1,3-diene (PubChem CID 67503363) has the molecular formula C5H4Br2 and a molecular weight of 223.90 g/mol. Its IUPAC name is 5,5-dibromocyclopenta-1,3-diene.
| Compound Name | 5,5-dibromocyclopenta-1,3-diene |
|---|---|
| PubChem CID | 67503363 |
| Molecular Formula | C5H4Br2 |
| Molecular Weight | 223.90 g/mol |
| Exact Mass | 221.87 |
| IUPAC Name | 5,5-dibromocyclopenta-1,3-diene |
| SMILES | BrC1(Br)C=CC=C1 |
| InChI | InChI=1S/C5H4Br2/c6-5(7)3-1-2-4-5/h1-4H |
| InChIKey | GQZYIRUXERCXQV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.90 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|