C18H34NP — CID 102114276
(2,5-ditert-butyl-1H-pyrrol-3-yl)-di(propan-2-yl)phosphane (PubChem CID 102114276) has the molecular formula C18H34NP and a molecular weight of 295.45 g/mol. Its IUPAC name is (2,5-ditert-butyl-1H-pyrrol-3-yl)-di(propan-2-yl)phosphane.
| Compound Name | (2,5-ditert-butyl-1H-pyrrol-3-yl)-di(propan-2-yl)phosphane |
|---|---|
| PubChem CID | 102114276 |
| Molecular Formula | C18H34NP |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.24 |
| IUPAC Name | (2,5-ditert-butyl-1H-pyrrol-3-yl)-di(propan-2-yl)phosphane |
| SMILES | CC(C)P(c1cc(C(C)(C)C)[nH]c1C(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H34NP/c1-12(2)20(13(3)4)14-11-15(17(5,6)7)19-16(14)18(8,9)10/h11-13,19H,1-10H3 |
| InChIKey | XZLJTLQQUOPBKN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|