C12H20O2 — CID 59168586
3,5-ditert-butyl-3H-furan-2-one (PubChem CID 59168586) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 3,5-ditert-butyl-3H-furan-2-one.
| Compound Name | 3,5-ditert-butyl-3H-furan-2-one |
|---|---|
| PubChem CID | 59168586 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 3,5-ditert-butyl-3H-furan-2-one |
| SMILES | CC(C)(C)C1C=C(OC1=O)C(C)(C)C |
| InChI | InChI=1S/C12H20O2/c1-11(2,3)8-7-9(12(4,5)6)14-10(8)13/h7-8H,1-6H3 |
| InChIKey | RTQFLFPAAPIMDQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 274 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |