C12H21P — CID 18913936
2,5-ditert-butyl-2H-phosphole (PubChem CID 18913936) has the molecular formula C12H21P and a molecular weight of 196.27 g/mol. Its IUPAC name is 2,5-ditert-butyl-2H-phosphole.
| Compound Name | 2,5-ditert-butyl-2H-phosphole |
|---|---|
| PubChem CID | 18913936 |
| Molecular Formula | C12H21P |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 2,5-ditert-butyl-2H-phosphole |
| SMILES | CC(C)(C)C1=PC(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C12H21P/c1-11(2,3)9-7-8-10(13-9)12(4,5)6/h7-9H,1-6H3 |
| InChIKey | JXPZPYGHNLFOJM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|