C14H25P — CID 139104236
2,5-ditert-butyl-3,4-dimethyl-2H-phosphole (PubChem CID 139104236) has the molecular formula C14H25P and a molecular weight of 224.33 g/mol. Its IUPAC name is 2,5-ditert-butyl-3,4-dimethyl-2H-phosphole.
| Compound Name | 2,5-ditert-butyl-3,4-dimethyl-2H-phosphole |
|---|---|
| PubChem CID | 139104236 |
| Molecular Formula | C14H25P |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 2,5-ditert-butyl-3,4-dimethyl-2H-phosphole |
| SMILES | CC1=C(C)C(C(C)(C)C)P=C1C(C)(C)C |
| InChI | InChI=1S/C14H25P/c1-9-10(2)12(14(6,7)8)15-11(9)13(3,4)5/h11H,1-8H3 |
| InChIKey | SSTPFBASWXMJEN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|