C15H27P3 — CID 86056990
4,5,6-tritert-butyltriphosphinine (PubChem CID 86056990) has the molecular formula C15H27P3 and a molecular weight of 300.30 g/mol. Its IUPAC name is 4,5,6-tritert-butyltriphosphinine.
| Compound Name | 4,5,6-tritert-butyltriphosphinine |
|---|---|
| PubChem CID | 86056990 |
| Molecular Formula | C15H27P3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4,5,6-tritert-butyltriphosphinine |
| SMILES | CC(C)(C)c1pppc(C(C)(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C15H27P3/c1-13(2,3)10-11(14(4,5)6)16-18-17-12(10)15(7,8)9/h1-9H3 |
| InChIKey | KIBSFBWHARQZFU-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |