C19H36P2Si — CID 6421181
trimethyl-(2,5,6-tritert-butyl-1,3-diphosphinin-4-yl)silane (PubChem CID 6421181) has the molecular formula C19H36P2Si and a molecular weight of 354.53 g/mol. Its IUPAC name is trimethyl-(2,5,6-tritert-butyl-1,3-diphosphinin-4-yl)silane.
| Compound Name | trimethyl-(2,5,6-tritert-butyl-1,3-diphosphinin-4-yl)silane |
|---|---|
| PubChem CID | 6421181 |
| Molecular Formula | C19H36P2Si |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | trimethyl-(2,5,6-tritert-butyl-1,3-diphosphinin-4-yl)silane |
| SMILES | CC(C)(C)c1pc(C(C)(C)C)c(C(C)(C)C)c([Si](C)(C)C)p1 |
| InChI | InChI=1S/C19H36P2Si/c1-17(2,3)13-14(18(4,5)6)20-16(19(7,8)9)21-15(13)22(10,11)12/h1-12H3 |
| InChIKey | YMXHPFFZPFXMOD-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|