C18H36P2Sn — CID 86074512
trimethyl-(2,4,5-tritert-butyl-1,3-diphosphol-2-yl)stannane (PubChem CID 86074512) has the molecular formula C18H36P2Sn and a molecular weight of 433.15 g/mol. Its IUPAC name is trimethyl-(2,4,5-tritert-butyl-1,3-diphosphol-2-yl)stannane.
| Compound Name | trimethyl-(2,4,5-tritert-butyl-1,3-diphosphol-2-yl)stannane |
|---|---|
| PubChem CID | 86074512 |
| Molecular Formula | C18H36P2Sn |
| Molecular Weight | 433.15 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | trimethyl-(2,4,5-tritert-butyl-1,3-diphosphol-2-yl)stannane |
| SMILES | CC(C)(C)C1=PC(C(C)(C)C)([Sn](C)(C)C)P=C1C(C)(C)C |
| InChI | InChI=1S/C15H27P2.3CH3.Sn/c1-13(2,3)10-11(14(4,5)6)17-12(16-10)15(7,8)9;;;;/h1-9H3;3*1H3; |
| InChIKey | XQXAOAKDQVTMMA-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.15 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|