C14H24N2 — CID 143714636
2,5-ditert-butyl-3,6-dimethylpyrazine (PubChem CID 143714636) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 2,5-ditert-butyl-3,6-dimethylpyrazine.
| Compound Name | 2,5-ditert-butyl-3,6-dimethylpyrazine |
|---|---|
| PubChem CID | 143714636 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 2,5-ditert-butyl-3,6-dimethylpyrazine |
| SMILES | Cc1nc(C(C)(C)C)c(C)nc1C(C)(C)C |
| InChI | InChI=1S/C14H24N2/c1-9-11(13(3,4)5)16-10(2)12(15-9)14(6,7)8/h1-8H3 |
| InChIKey | VJERRFDSWUHWPV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |