C14H20P2 — CID 22971709
2,3,4-trimethyl-5-(2,3,4-trimethyl-2H-phosphol-5-yl)-2H-phosphole (PubChem CID 22971709) has the molecular formula C14H20P2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-(2,3,4-trimethyl-2H-phosphol-5-yl)-2H-phosphole.
| Compound Name | 2,3,4-trimethyl-5-(2,3,4-trimethyl-2H-phosphol-5-yl)-2H-phosphole |
|---|---|
| PubChem CID | 22971709 |
| Molecular Formula | C14H20P2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2,3,4-trimethyl-5-(2,3,4-trimethyl-2H-phosphol-5-yl)-2H-phosphole |
| SMILES | CC1=C(C)C(C)P=C1C1=PC(C)C(C)=C1C |
| InChI | InChI=1S/C14H20P2/c1-7-9(3)13(15-11(7)5)14-10(4)8(2)12(6)16-14/h11-12H,1-6H3 |
| InChIKey | QBNODNXZOTYLLE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|