C18H32 — CID 162283851
ethane;1,2,3,4,5,6,7-heptamethyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 162283851) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is ethane;1,2,3,4,5,6,7-heptamethyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | ethane;1,2,3,4,5,6,7-heptamethyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 162283851 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | ethane;1,2,3,4,5,6,7-heptamethyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC.CC1=C(C)C2C(C)C(C)C(C)C2C(C)=C1C |
| InChI | InChI=1S/C16H26.C2H6/c1-8-9(2)12(5)16-14(7)10(3)13(6)15(16)11(8)4;1-2/h10,13-16H,1-7H3;1-2H3 |
| InChIKey | VFHYUUUBBXJQAM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |